C26H39N5O5SSi — CID 58520497
[2-amino-9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 58520497) has the molecular formula C26H39N5O5SSi and a molecular weight of 561.78 g/mol. Its IUPAC name is [2-amino-9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [2-amino-9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 58520497 |
| Molecular Formula | C26H39N5O5SSi |
| Molecular Weight | 561.78 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | [2-amino-9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(OS(=O)(=O)c4c(C)cc(C)cc4C)nc(N)nc32)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H39N5O5SSi/c1-10-18-19(36-38(8,9)26(5,6)7)13-20(34-18)31-14-28-21-23(31)29-25(27)30-24(21)35-37(32,33)22-16(3)11-15(2)12-17(22)4/h11-12,14,18-20H,10,13H2,1-9H3,(H2,27,29,30)/t18-,19?,20-/m1/s1 |
| InChIKey | NOMMGBHVAGUDNV-YSSMNDQQSA-N |
| XLogP | 5.19 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.78 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|