C19H21N7O6S — CID 15540001
[2-azido-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 15540001) has the molecular formula C19H21N7O6S and a molecular weight of 475.49 g/mol. Its IUPAC name is [2-azido-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [2-azido-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 15540001 |
| Molecular Formula | C19H21N7O6S |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | [2-azido-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2nc(N=[N+]=[N-])nc3c2ncn3[C@H]2C[C@H](O)[C@@H](CO)O2)c(C)c1 |
| InChI | InChI=1S/C19H21N7O6S/c1-9-4-10(2)16(11(3)5-9)33(29,30)32-18-15-17(22-19(23-18)24-25-20)26(8-21-15)14-6-12(28)13(7-27)31-14/h4-5,8,12-14,27-28H,6-7H2,1-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | JLGGMSMWLCGEGO-BFHYXJOUSA-N |
| XLogP | 2.10 |
| TPSA | 185.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|