C10H12N8O3 — CID 510979
(2R,3S,5R)-5-(6-amino-2-azidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 510979) has the molecular formula C10H12N8O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-amino-2-azidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(6-amino-2-azidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 510979 |
| Molecular Formula | C10H12N8O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (2R,3S,5R)-5-(6-amino-2-azidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=Nc1nc(N)c2ncn([C@H]3C[C@H](O)[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C10H12N8O3/c11-8-7-9(15-10(14-8)16-17-12)18(3-13-7)6-1-4(20)5(2-19)21-6/h3-6,19-20H,1-2H2,(H2,11,14,15)/t4-,5+,6+/m0/s1 |
| InChIKey | PLBOKIVEVSWRNR-KVQBGUIXSA-N |
| XLogP | -0.01 |
| TPSA | 168.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|