C11H12N6O3 — CID 15217056
(2R,3S,5R)-5-(4-azidoimidazo[4,5-c]pyridin-1-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 15217056) has the molecular formula C11H12N6O3 and a molecular weight of 276.26 g/mol. Its IUPAC name is (2R,3S,5R)-5-(4-azidoimidazo[4,5-c]pyridin-1-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(4-azidoimidazo[4,5-c]pyridin-1-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 15217056 |
| Molecular Formula | C11H12N6O3 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (2R,3S,5R)-5-(4-azidoimidazo[4,5-c]pyridin-1-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=Nc1nccc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H12N6O3/c12-16-15-11-10-6(1-2-13-11)17(5-14-10)9-3-7(19)8(4-18)20-9/h1-2,5,7-9,18-19H,3-4H2/t7-,8+,9+/m0/s1 |
| InChIKey | JWLAIVKYAVXDES-DJLDLDEBSA-N |
| XLogP | 1.01 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|