C11H13N7O3 — CID 21157929
2-(4-aminoimidazo[4,5-c]pyridin-1-yl)-4-azido-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 21157929) has the molecular formula C11H13N7O3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-(4-aminoimidazo[4,5-c]pyridin-1-yl)-4-azido-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | 2-(4-aminoimidazo[4,5-c]pyridin-1-yl)-4-azido-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 21157929 |
| Molecular Formula | C11H13N7O3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-(4-aminoimidazo[4,5-c]pyridin-1-yl)-4-azido-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=NC1C(CO)OC(n2cnc3c(N)nccc32)C1O |
| InChI | InChI=1S/C11H13N7O3/c12-10-7-5(1-2-14-10)18(4-15-7)11-9(20)8(16-17-13)6(3-19)21-11/h1-2,4,6,8-9,11,19-20H,3H2,(H2,12,14) |
| InChIKey | FLTBHNPQDQEMJX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 155.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|