C10H15N7O3 — CID 154718024
5-(6-amino-2-hydrazinylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 154718024) has the molecular formula C10H15N7O3 and a molecular weight of 281.28 g/mol. Its IUPAC name is 5-(6-amino-2-hydrazinylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | 5-(6-amino-2-hydrazinylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 154718024 |
| Molecular Formula | C10H15N7O3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-(6-amino-2-hydrazinylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | NNc1nc(N)c2ncn(C3CC(O)C(CO)O3)c2n1 |
| InChI | InChI=1S/C10H15N7O3/c11-8-7-9(15-10(14-8)16-12)17(3-13-7)6-1-4(19)5(2-18)20-6/h3-6,18-19H,1-2,12H2,(H3,11,14,15,16) |
| InChIKey | PVBTZBGACFSXPR-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 157.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|