C17H19N5O6S — CID 15216867
[6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl] 4-methylbenzenesulfonate (PubChem CID 15216867) has the molecular formula C17H19N5O6S and a molecular weight of 421.44 g/mol. Its IUPAC name is [6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15216867 |
| Molecular Formula | C17H19N5O6S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nc(N)c3ncn([C@H]4C[C@H](O)[C@@H](CO)O4)c3n2)cc1 |
| InChI | InChI=1S/C17H19N5O6S/c1-9-2-4-10(5-3-9)29(25,26)28-17-20-15(18)14-16(21-17)22(8-19-14)13-6-11(24)12(7-23)27-13/h2-5,8,11-13,23-24H,6-7H2,1H3,(H2,18,20,21)/t11-,12+,13+/m0/s1 |
| InChIKey | WAIFWFLQTROQMC-YNEHKIRRSA-N |
| XLogP | 0.13 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|