C17H18IN5O3 — CID 88641514
[(2R,3S)-5-(6-amino-2-iodopurin-9-yl)-3-(4-methylphenoxy)oxolan-2-yl]methanol (PubChem CID 88641514) has the molecular formula C17H18IN5O3 and a molecular weight of 467.27 g/mol. Its IUPAC name is [(2R,3S)-5-(6-amino-2-iodopurin-9-yl)-3-(4-methylphenoxy)oxolan-2-yl]methanol.
| Compound Name | [(2R,3S)-5-(6-amino-2-iodopurin-9-yl)-3-(4-methylphenoxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 88641514 |
| Molecular Formula | C17H18IN5O3 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | [(2R,3S)-5-(6-amino-2-iodopurin-9-yl)-3-(4-methylphenoxy)oxolan-2-yl]methanol |
| SMILES | Cc1ccc(O[C@H]2CC(n3cnc4c(N)nc(I)nc43)O[C@@H]2CO)cc1 |
| InChI | InChI=1S/C17H18IN5O3/c1-9-2-4-10(5-3-9)25-11-6-13(26-12(11)7-24)23-8-20-14-15(19)21-17(18)22-16(14)23/h2-5,8,11-13,24H,6-7H2,1H3,(H2,19,21,22)/t11-,12+,13?/m0/s1 |
| InChIKey | KTUKXPVUYRVGMX-LAGVYOHYSA-N |
| XLogP | 2.05 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|