C11H15N5O2 — CID 143654262
[(2S)-5-(6-amino-2-methylpurin-9-yl)oxolan-2-yl]methanol (PubChem CID 143654262) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is [(2S)-5-(6-amino-2-methylpurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S)-5-(6-amino-2-methylpurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 143654262 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [(2S)-5-(6-amino-2-methylpurin-9-yl)oxolan-2-yl]methanol |
| SMILES | Cc1nc(N)c2ncn(C3CC[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C11H15N5O2/c1-6-14-10(12)9-11(15-6)16(5-13-9)8-3-2-7(4-17)18-8/h5,7-8,17H,2-4H2,1H3,(H2,12,14,15)/t7-,8?/m0/s1 |
| InChIKey | YHPZZYHUFSCIGO-JAMMHHFISA-N |
| XLogP | 0.39 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |