C25H27N5O2 — CID 142032624
[5-[6-(2,2-diphenylethylamino)-2-methylpurin-9-yl]oxolan-2-yl]methanol (PubChem CID 142032624) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is [5-[6-(2,2-diphenylethylamino)-2-methylpurin-9-yl]oxolan-2-yl]methanol.
| Compound Name | [5-[6-(2,2-diphenylethylamino)-2-methylpurin-9-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 142032624 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [5-[6-(2,2-diphenylethylamino)-2-methylpurin-9-yl]oxolan-2-yl]methanol |
| SMILES | Cc1nc(NCC(c2ccccc2)c2ccccc2)c2ncn(C3CCC(CO)O3)c2n1 |
| InChI | InChI=1S/C25H27N5O2/c1-17-28-24(23-25(29-17)30(16-27-23)22-13-12-20(15-31)32-22)26-14-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,16,20-22,31H,12-15H2,1H3,(H,26,28,29) |
| InChIKey | WOVKKAWNYGXPKN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |