C32H40N8O3 — CID 142081087
N-[3-(dimethylamino)propyl]-6-(2,2-diphenylethylamino)-9-[5-(ethylcarbamoyl)oxolan-2-yl]purine-2-carboxamide (PubChem CID 142081087) has the molecular formula C32H40N8O3 and a molecular weight of 584.73 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-6-(2,2-diphenylethylamino)-9-[5-(ethylcarbamoyl)oxolan-2-yl]purine-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-6-(2,2-diphenylethylamino)-9-[5-(ethylcarbamoyl)oxolan-2-yl]purine-2-carboxamide |
|---|---|
| PubChem CID | 142081087 |
| Molecular Formula | C32H40N8O3 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-6-(2,2-diphenylethylamino)-9-[5-(ethylcarbamoyl)oxolan-2-yl]purine-2-carboxamide |
| SMILES | CCNC(=O)C1CCC(n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)NCCCN(C)C)nc32)O1 |
| InChI | InChI=1S/C32H40N8O3/c1-4-33-31(41)25-16-17-26(43-25)40-21-36-27-28(37-29(38-30(27)40)32(42)34-18-11-19-39(2)3)35-20-24(22-12-7-5-8-13-22)23-14-9-6-10-15-23/h5-10,12-15,21,24-26H,4,11,16-20H2,1-3H3,(H,33,41)(H,34,42)(H,35,37,38) |
| InChIKey | UDBMQWUSNVBJLV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|