C35H44N8O5 — CID 10211725
6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-(4-methylpiperidin-1-yl)ethyl]purine-2-carboxamide (PubChem CID 10211725) has the molecular formula C35H44N8O5 and a molecular weight of 656.79 g/mol. Its IUPAC name is 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-(4-methylpiperidin-1-yl)ethyl]purine-2-carboxamide.
| Compound Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-(4-methylpiperidin-1-yl)ethyl]purine-2-carboxamide |
|---|---|
| PubChem CID | 10211725 |
| Molecular Formula | C35H44N8O5 |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-(4-methylpiperidin-1-yl)ethyl]purine-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)NCCN4CCC(C)CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H44N8O5/c1-3-36-33(46)29-27(44)28(45)35(48-29)43-21-39-26-30(38-20-25(23-10-6-4-7-11-23)24-12-8-5-9-13-24)40-31(41-32(26)43)34(47)37-16-19-42-17-14-22(2)15-18-42/h4-13,21-22,25,27-29,35,44-45H,3,14-20H2,1-2H3,(H,36,46)(H,37,47)(H,38,40,41)/t27-,28+,29-,35+/m0/s1 |
| InChIKey | ANGJTPXTEDBIRI-LQHHRKQYSA-N |
| XLogP | 2.29 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |