C29H36N10O4 — CID 67639690
(2S,3S,4R,5R)-5-[2-[2-(diaminomethylideneamino)ethylamino]-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 67639690) has the molecular formula C29H36N10O4 and a molecular weight of 588.67 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-[2-(diaminomethylideneamino)ethylamino]-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-[2-(diaminomethylideneamino)ethylamino]-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 67639690 |
| Molecular Formula | C29H36N10O4 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-[2-(diaminomethylideneamino)ethylamino]-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NCCN=C(N)N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H36N10O4/c1-2-32-26(42)23-21(40)22(41)27(43-23)39-16-36-20-24(37-29(38-25(20)39)34-14-13-33-28(30)31)35-15-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19,21-23,27,40-41H,2,13-15H2,1H3,(H,32,42)(H4,30,31,33)(H2,34,35,37,38)/t21-,22+,23-,27+/m0/s1 |
| InChIKey | FAPNVYRZBFYODX-NBCVKUGOSA-N |
| XLogP | 0.51 |
| TPSA | 210.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|