C29H31N9O4 — CID 66630806
(2S,3S,4R,5R)-5-[2-(4-aminoimidazol-1-yl)-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 66630806) has the molecular formula C29H31N9O4 and a molecular weight of 569.63 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(4-aminoimidazol-1-yl)-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(4-aminoimidazol-1-yl)-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 66630806 |
| Molecular Formula | C29H31N9O4 |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(4-aminoimidazol-1-yl)-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(-n4cnc(N)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H31N9O4/c1-2-31-27(41)24-22(39)23(40)28(42-24)38-16-34-21-25(35-29(36-26(21)38)37-14-20(30)33-15-37)32-13-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,14-16,19,22-24,28,39-40H,2,13,30H2,1H3,(H,31,41)(H,32,35,36)/t22-,23+,24-,28+/m0/s1 |
| InChIKey | WQCWNDKJVNWACE-NLJXWPIHSA-N |
| XLogP | 1.59 |
| TPSA | 178.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |