C29H34N8O5 — CID 11192424
N-(2-aminoethyl)-6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carboxamide (PubChem CID 11192424) has the molecular formula C29H34N8O5 and a molecular weight of 574.64 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carboxamide |
|---|---|
| PubChem CID | 11192424 |
| Molecular Formula | C29H34N8O5 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | N-(2-aminoethyl)-6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)NCCN)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H34N8O5/c1-2-31-27(40)23-21(38)22(39)29(42-23)37-16-34-20-24(35-25(36-26(20)37)28(41)32-14-13-30)33-15-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19,21-23,29,38-39H,2,13-15,30H2,1H3,(H,31,40)(H,32,41)(H,33,35,36)/t21-,22+,23-,29+/m0/s1 |
| InChIKey | YMNZWLFPHCJDLQ-LQZKXZFMSA-N |
| XLogP | 0.51 |
| TPSA | 189.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |