C31H36N8O5 — CID 18345894
6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-pyrrolidin-1-ylpurine-2-carboxamide (PubChem CID 18345894) has the molecular formula C31H36N8O5 and a molecular weight of 600.68 g/mol. Its IUPAC name is 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-pyrrolidin-1-ylpurine-2-carboxamide.
| Compound Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-pyrrolidin-1-ylpurine-2-carboxamide |
|---|---|
| PubChem CID | 18345894 |
| Molecular Formula | C31H36N8O5 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-pyrrolidin-1-ylpurine-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)NN4CCCC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H36N8O5/c1-2-32-29(42)25-23(40)24(41)31(44-25)39-18-34-22-26(35-27(36-28(22)39)30(43)37-38-15-9-10-16-38)33-17-21(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-8,11-14,18,21,23-25,31,40-41H,2,9-10,15-17H2,1H3,(H,32,42)(H,37,43)(H,33,35,36)/t23-,24+,25-,31+/m0/s1 |
| InChIKey | IWSGMMXVRLHKJS-TXHDDHBJSA-N |
| XLogP | 1.57 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |