C27H29N7O6S — CID 87889129
(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(sulfonylamino)methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 87889129) has the molecular formula C27H29N7O6S and a molecular weight of 579.64 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(sulfonylamino)methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(sulfonylamino)methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 87889129 |
| Molecular Formula | C27H29N7O6S |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(sulfonylamino)methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(CN=S(=O)=O)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H29N7O6S/c1-2-28-26(37)23-21(35)22(36)27(40-23)34-15-30-20-24(32-19(33-25(20)34)14-31-41(38)39)29-13-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15,18,21-23,27,35-36H,2,13-14H2,1H3,(H,28,37)(H,29,32,33)/t21-,22+,23-,27+/m0/s1 |
| InChIKey | PXHLHRRESXOZNN-NBCVKUGOSA-N |
| XLogP | 1.39 |
| TPSA | 180.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |