C29H36N8O4 — CID 67639912
(2S,3S,4R,5R)-5-[2-(3-aminopropylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 67639912) has the molecular formula C29H36N8O4 and a molecular weight of 560.66 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(3-aminopropylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(3-aminopropylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 67639912 |
| Molecular Formula | C29H36N8O4 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(3-aminopropylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NCCCN)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H36N8O4/c1-2-31-27(40)24-22(38)23(39)28(41-24)37-17-34-21-25(35-29(36-26(21)37)32-15-9-14-30)33-16-20(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-8,10-13,17,20,22-24,28,38-39H,2,9,14-16,30H2,1H3,(H,31,40)(H2,32,33,35,36)/t22-,23+,24-,28+/m0/s1 |
| InChIKey | GVWIJMHTEQYKFG-NLJXWPIHSA-N |
| XLogP | 1.59 |
| TPSA | 172.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|