C32H40N8O4 — CID 139693159
(2S,3S,4R)-N-(2-deuterioethyl)-5-[6-(2,2-diphenylethylamino)-2-[(1-ethylpyrrolidin-3-yl)amino]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 139693159) has the molecular formula C32H40N8O4 and a molecular weight of 601.73 g/mol. Its IUPAC name is (2S,3S,4R)-N-(2-deuterioethyl)-5-[6-(2,2-diphenylethylamino)-2-[(1-ethylpyrrolidin-3-yl)amino]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R)-N-(2-deuterioethyl)-5-[6-(2,2-diphenylethylamino)-2-[(1-ethylpyrrolidin-3-yl)amino]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 139693159 |
| Molecular Formula | C32H40N8O4 |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | (2S,3S,4R)-N-(2-deuterioethyl)-5-[6-(2,2-diphenylethylamino)-2-[(1-ethylpyrrolidin-3-yl)amino]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | [2H]CCNC(=O)[C@H]1OC(n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NC4CCN(CC)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H40N8O4/c1-3-33-30(43)27-25(41)26(42)31(44-27)40-19-35-24-28(37-32(38-29(24)40)36-22-15-16-39(4-2)18-22)34-17-23(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22-23,25-27,31,41-42H,3-4,15-18H2,1-2H3,(H,33,43)(H2,34,36,37,38)/t22?,25-,26+,27-,31?/m0/s1/i1D |
| InChIKey | XLEMAGNEXGTRJK-QJPGORNASA-N |
| XLogP | 2.33 |
| TPSA | 149.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |