C35H44N8O6 — CID 66645846
tert-butyl N-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidin-3-yl]carbamate (PubChem CID 66645846) has the molecular formula C35H44N8O6 and a molecular weight of 672.79 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66645846 |
| Molecular Formula | C35H44N8O6 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | tert-butyl N-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CCNC(=O)[C@H]1OC(n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(N4CC[C@@H](NC(=O)OC(C)(C)C)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H44N8O6/c1-5-36-31(46)28-26(44)27(45)32(48-28)43-20-38-25-29(37-18-24(21-12-8-6-9-13-21)22-14-10-7-11-15-22)40-33(41-30(25)43)42-17-16-23(19-42)39-34(47)49-35(2,3)4/h6-15,20,23-24,26-28,32,44-45H,5,16-19H2,1-4H3,(H,36,46)(H,39,47)(H,37,40,41)/t23-,26+,27-,28+,32?/m1/s1 |
| InChIKey | VTZNTPXHPQNNOC-PGPXMDMFSA-N |
| XLogP | 2.93 |
| TPSA | 175.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |