C39H49F3N8O7 — CID 66631021
tert-butyl N-[1-[9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-(propanoylamino)cyclopentyl]-6-(2,2-diphenylethylamino)purin-2-yl]piperidin-4-yl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 66631021) has the molecular formula C39H49F3N8O7 and a molecular weight of 798.86 g/mol. Its IUPAC name is tert-butyl N-[1-[9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-(propanoylamino)cyclopentyl]-6-(2,2-diphenylethylamino)purin-2-yl]piperidin-4-yl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl N-[1-[9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-(propanoylamino)cyclopentyl]-6-(2,2-diphenylethylamino)purin-2-yl]piperidin-4-yl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66631021 |
| Molecular Formula | C39H49F3N8O7 |
| Molecular Weight | 798.86 g/mol |
| Exact Mass | 798.37 |
| IUPAC Name | tert-butyl N-[1-[9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-(propanoylamino)cyclopentyl]-6-(2,2-diphenylethylamino)purin-2-yl]piperidin-4-yl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(N4CCC(NC(=O)OC(C)(C)C)CC4)nc32)[C@H](O)[C@@H]1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C37H48N8O5.C2HF3O2/c1-5-29(46)41-27-20-28(32(48)31(27)47)45-22-39-30-33(38-21-26(23-12-8-6-9-13-23)24-14-10-7-11-15-24)42-35(43-34(30)45)44-18-16-25(17-19-44)40-36(49)50-37(2,3)4;3-2(4,5)1(6)7/h6-15,22,25-28,31-32,47-48H,5,16-21H2,1-4H3,(H,40,49)(H,41,46)(H,38,42,43);(H,6,7)/t27-,28+,31+,32-;/m0./s1 |
| InChIKey | SJUXDZSUVWOLDO-MQSDYMNNSA-N |
| XLogP | 4.76 |
| TPSA | 204.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |