C37H48N10O4 — CID 24771024
N-[(3R)-1-[9-[(2S,3R,4S)-2,3-dihydroxy-4-(propanoylamino)cyclopentyl]-6-(2,2-diphenylethylamino)purin-2-yl]pyrrolidin-3-yl]-4-methylpiperazine-1-carboxamide (PubChem CID 24771024) has the molecular formula C37H48N10O4 and a molecular weight of 696.86 g/mol. Its IUPAC name is N-[(3R)-1-[9-[(2S,3R,4S)-2,3-dihydroxy-4-(propanoylamino)cyclopentyl]-6-(2,2-diphenylethylamino)purin-2-yl]pyrrolidin-3-yl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[(3R)-1-[9-[(2S,3R,4S)-2,3-dihydroxy-4-(propanoylamino)cyclopentyl]-6-(2,2-diphenylethylamino)purin-2-yl]pyrrolidin-3-yl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 24771024 |
| Molecular Formula | C37H48N10O4 |
| Molecular Weight | 696.86 g/mol |
| Exact Mass | 696.39 |
| IUPAC Name | N-[(3R)-1-[9-[(2S,3R,4S)-2,3-dihydroxy-4-(propanoylamino)cyclopentyl]-6-(2,2-diphenylethylamino)purin-2-yl]pyrrolidin-3-yl]-4-methylpiperazine-1-carboxamide |
| SMILES | CCC(=O)N[C@H]1CC(n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(N4CC[C@@H](NC(=O)N5CCN(C)CC5)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C37H48N10O4/c1-3-30(48)41-28-20-29(33(50)32(28)49)47-23-39-31-34(38-21-27(24-10-6-4-7-11-24)25-12-8-5-9-13-25)42-36(43-35(31)47)46-15-14-26(22-46)40-37(51)45-18-16-44(2)17-19-45/h4-13,23,26-29,32-33,49-50H,3,14-22H2,1-2H3,(H,40,51)(H,41,48)(H,38,42,43)/t26-,28+,29?,32-,33+/m1/s1 |
| InChIKey | APZDBPXDHZPQPA-YTTKIGDDSA-N |
| XLogP | 2.17 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |