C36H41N9O4S — CID 24771750
N-[(1S,2R,3S)-4-[6-(2,2-diphenylethylamino)-2-[(3R)-3-(thiophen-2-ylcarbamoylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 24771750) has the molecular formula C36H41N9O4S and a molecular weight of 695.85 g/mol. Its IUPAC name is N-[(1S,2R,3S)-4-[6-(2,2-diphenylethylamino)-2-[(3R)-3-(thiophen-2-ylcarbamoylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S)-4-[6-(2,2-diphenylethylamino)-2-[(3R)-3-(thiophen-2-ylcarbamoylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 24771750 |
| Molecular Formula | C36H41N9O4S |
| Molecular Weight | 695.85 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | N-[(1S,2R,3S)-4-[6-(2,2-diphenylethylamino)-2-[(3R)-3-(thiophen-2-ylcarbamoylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1CC(n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(N4CC[C@@H](NC(=O)Nc5cccs5)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C36H41N9O4S/c1-2-28(46)40-26-18-27(32(48)31(26)47)45-21-38-30-33(37-19-25(22-10-5-3-6-11-22)23-12-7-4-8-13-23)42-35(43-34(30)45)44-16-15-24(20-44)39-36(49)41-29-14-9-17-50-29/h3-14,17,21,24-27,31-32,47-48H,2,15-16,18-20H2,1H3,(H,40,46)(H,37,42,43)(H2,39,41,49)/t24-,26+,27?,31-,32+/m1/s1 |
| InChIKey | BPIPFIKPDHIXEP-TVXOEEHUSA-N |
| XLogP | 4.09 |
| TPSA | 169.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |