C37H42N10O4 — CID 24771618
N-[(1S,2R,3S)-4-[6-(2,2-diphenylethylamino)-2-[(3S)-3-(pyridin-4-ylcarbamoylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 24771618) has the molecular formula C37H42N10O4 and a molecular weight of 690.81 g/mol. Its IUPAC name is N-[(1S,2R,3S)-4-[6-(2,2-diphenylethylamino)-2-[(3S)-3-(pyridin-4-ylcarbamoylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S)-4-[6-(2,2-diphenylethylamino)-2-[(3S)-3-(pyridin-4-ylcarbamoylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 24771618 |
| Molecular Formula | C37H42N10O4 |
| Molecular Weight | 690.81 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | N-[(1S,2R,3S)-4-[6-(2,2-diphenylethylamino)-2-[(3S)-3-(pyridin-4-ylcarbamoylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1CC(n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(N4CC[C@H](NC(=O)Nc5ccncc5)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C37H42N10O4/c1-2-30(48)43-28-19-29(33(50)32(28)49)47-22-40-31-34(39-20-27(23-9-5-3-6-10-23)24-11-7-4-8-12-24)44-36(45-35(31)47)46-18-15-26(21-46)42-37(51)41-25-13-16-38-17-14-25/h3-14,16-17,22,26-29,32-33,49-50H,2,15,18-21H2,1H3,(H,43,48)(H,39,44,45)(H2,38,41,42,51)/t26-,28-,29?,32+,33-/m0/s1 |
| InChIKey | UQDXIACDXXKFNU-CQXBUJHRSA-N |
| XLogP | 3.43 |
| TPSA | 182.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |