C33H33N7O8 — CID 123976458
(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(3R)-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]pyrrolidin-1-yl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxylic acid (PubChem CID 123976458) has the molecular formula C33H33N7O8 and a molecular weight of 655.67 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(3R)-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]pyrrolidin-1-yl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(3R)-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]pyrrolidin-1-yl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 123976458 |
| Molecular Formula | C33H33N7O8 |
| Molecular Weight | 655.67 g/mol |
| Exact Mass | 655.24 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(3R)-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]pyrrolidin-1-yl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxylic acid |
| SMILES | COc1c(N[C@@H]2CCN(c3nc(NCC(c4ccccc4)c4ccccc4)c4ncn([C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H]5O)c4n3)C2)c(=O)c1=O |
| InChI | InChI=1S/C33H33N7O8/c1-47-27-21(23(41)24(27)42)36-19-12-13-39(15-19)33-37-29(34-14-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18)22-30(38-33)40(16-35-22)31-26(44)25(43)28(48-31)32(45)46/h2-11,16,19-20,25-26,28,31,36,43-44H,12-15H2,1H3,(H,45,46)(H,34,37,38)/t19-,25+,26-,28+,31-/m1/s1 |
| InChIKey | ORXYTFLQBWTYIQ-IASUGENPSA-N |
| XLogP | 1.07 |
| TPSA | 201.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.67 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|