C35H44N8O6 — CID 66629739
tert-butyl (2R)-2-amino-1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidine-3-carboxylate (PubChem CID 66629739) has the molecular formula C35H44N8O6 and a molecular weight of 672.79 g/mol. Its IUPAC name is tert-butyl (2R)-2-amino-1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (2R)-2-amino-1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 66629739 |
| Molecular Formula | C35H44N8O6 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | tert-butyl (2R)-2-amino-1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]pyrrolidine-3-carboxylate |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(N4CCC(C(=O)OC(C)(C)C)[C@@H]4N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H44N8O6/c1-5-37-31(46)27-25(44)26(45)32(48-27)43-19-39-24-29(38-18-23(20-12-8-6-9-13-20)21-14-10-7-11-15-21)40-34(41-30(24)43)42-17-16-22(28(42)36)33(47)49-35(2,3)4/h6-15,19,22-23,25-28,32,44-45H,5,16-18,36H2,1-4H3,(H,37,46)(H,38,40,41)/t22?,25-,26+,27-,28+,32+/m0/s1 |
| InChIKey | SZAFYMHMYVPUPY-SIDUDFAQSA-N |
| XLogP | 2.28 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |