C35H44N6O6 — CID 157497288
tert-butyl N-[(3S)-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4,4-diphenylbutan-2-yl)purin-2-yl]pyrrolidin-3-yl]carbamate (PubChem CID 157497288) has the molecular formula C35H44N6O6 and a molecular weight of 644.77 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4,4-diphenylbutan-2-yl)purin-2-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4,4-diphenylbutan-2-yl)purin-2-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 157497288 |
| Molecular Formula | C35H44N6O6 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | tert-butyl N-[(3S)-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4,4-diphenylbutan-2-yl)purin-2-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(CC(c1ccccc1)c1ccccc1)c1nc(N2CC[C@H](NC(=O)OC(C)(C)C)C2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C35H44N6O6/c1-21(17-25(22-11-7-5-8-12-22)23-13-9-6-10-14-23)27-28-31(41(20-36-28)32-30(44)29(43)26(19-42)46-32)39-33(38-27)40-16-15-24(18-40)37-34(45)47-35(2,3)4/h5-14,20-21,24-26,29-30,32,42-44H,15-19H2,1-4H3,(H,37,45)/t21?,24-,26+,29+,30+,32+/m0/s1 |
| InChIKey | BXZGFKAPSWDGGN-KSOSWRCZSA-N |
| XLogP | 3.87 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |