C37H37F3N6O6 — CID 68961414
[(2R,3R,4R,5R)-2-[6-(2,2-diphenylethylamino)-2-[3-(4-methoxyphenyl)pyrrolidin-1-yl]purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 68961414) has the molecular formula C37H37F3N6O6 and a molecular weight of 718.73 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[6-(2,2-diphenylethylamino)-2-[3-(4-methoxyphenyl)pyrrolidin-1-yl]purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3R,4R,5R)-2-[6-(2,2-diphenylethylamino)-2-[3-(4-methoxyphenyl)pyrrolidin-1-yl]purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68961414 |
| Molecular Formula | C37H37F3N6O6 |
| Molecular Weight | 718.73 g/mol |
| Exact Mass | 718.27 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[6-(2,2-diphenylethylamino)-2-[3-(4-methoxyphenyl)pyrrolidin-1-yl]purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(C2CCN(c3nc(NCC(c4ccccc4)c4ccccc4)c4ncn([C@@H]5O[C@H](CO)[C@@H](O)[C@H]5OC(=O)C(F)(F)F)c4n3)C2)cc1 |
| InChI | InChI=1S/C37H37F3N6O6/c1-50-26-14-12-22(13-15-26)25-16-17-45(19-25)36-43-32(41-18-27(23-8-4-2-5-9-23)24-10-6-3-7-11-24)29-33(44-36)46(21-42-29)34-31(30(48)28(20-47)51-34)52-35(49)37(38,39)40/h2-15,21,25,27-28,30-31,34,47-48H,16-20H2,1H3,(H,41,43,44)/t25?,28-,30-,31-,34-/m1/s1 |
| InChIKey | QTYYXQSLWYLMKX-AEMUYHPKSA-N |
| XLogP | 4.80 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.73 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |