C35H36F3N7O8 — CID 25029194
[4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]piperazin-1-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 25029194) has the molecular formula C35H36F3N7O8 and a molecular weight of 739.71 g/mol. Its IUPAC name is [4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]piperazin-1-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]piperazin-1-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25029194 |
| Molecular Formula | C35H36F3N7O8 |
| Molecular Weight | 739.71 g/mol |
| Exact Mass | 739.26 |
| IUPAC Name | [4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]piperazin-1-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccco1)N1CCN(c2nc(NCC(c3ccccc3)c3ccccc3)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)CC1 |
| InChI | InChI=1S/C33H35N7O6.C2HF3O2/c41-19-25-27(42)28(43)32(46-25)40-20-35-26-29(34-18-23(21-8-3-1-4-9-21)22-10-5-2-6-11-22)36-33(37-30(26)40)39-15-13-38(14-16-39)31(44)24-12-7-17-45-24;3-2(4,5)1(6)7/h1-12,17,20,23,25,27-28,32,41-43H,13-16,18-19H2,(H,34,36,37);(H,6,7)/t25-,27-,28-,32-;/m1./s1 |
| InChIKey | QDMBBKCKEKZUCK-YPZOBWETSA-N |
| XLogP | 2.87 |
| TPSA | 199.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.71 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |