C36H43F3N6O8 — CID 161340007
(2R)-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]-2-ethylpiperidine-3-carboxylic acid;ethyl 2,2,2-trifluoroacetate (PubChem CID 161340007) has the molecular formula C36H43F3N6O8 and a molecular weight of 744.77 g/mol. Its IUPAC name is (2R)-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]-2-ethylpiperidine-3-carboxylic acid;ethyl 2,2,2-trifluoroacetate.
| Compound Name | (2R)-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]-2-ethylpiperidine-3-carboxylic acid;ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 161340007 |
| Molecular Formula | C36H43F3N6O8 |
| Molecular Weight | 744.77 g/mol |
| Exact Mass | 744.31 |
| IUPAC Name | (2R)-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]-2-ethylpiperidine-3-carboxylic acid;ethyl 2,2,2-trifluoroacetate |
| SMILES | CCOC(=O)C(F)(F)F.CC[C@@H]1C(C(=O)O)CCCN1c1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C32H38N6O6.C4H5F3O2/c1-2-23-21(31(42)43)14-9-15-37(23)32-35-28(33-16-22(19-10-5-3-6-11-19)20-12-7-4-8-13-20)25-29(36-32)38(18-34-25)30-27(41)26(40)24(17-39)44-30;1-2-9-3(8)4(5,6)7/h3-8,10-13,18,21-24,26-27,30,39-41H,2,9,14-17H2,1H3,(H,42,43)(H,33,35,36);2H2,1H3/t21?,23-,24-,26-,27-,30-;/m1./s1 |
| InChIKey | VMNQJVCFGQDGLE-QBLDRBOQSA-N |
| XLogP | 3.87 |
| TPSA | 192.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |