C32H34F3N11O4 — CID 67544014
[(2R,3S,4R,5R)-5-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 67544014) has the molecular formula C32H34F3N11O4 and a molecular weight of 693.69 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3S,4R,5R)-5-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67544014 |
| Molecular Formula | C32H34F3N11O4 |
| Molecular Weight | 693.69 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(N5CC[C@@H](N)C5)nc43)[C@H](O)[C@@H]2OC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C32H34F3N11O4/c1-2-46-42-27(41-43-46)25-24(50-30(48)32(33,34)35)23(47)29(49-25)45-17-38-22-26(39-31(40-28(22)45)44-14-13-20(36)16-44)37-15-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17,20-21,23-25,29,47H,2,13-16,36H2,1H3,(H,37,39,40)/t20-,23-,24+,25+,29-/m1/s1 |
| InChIKey | OBSRRIZSVLXHRZ-LHGWCKCFSA-N |
| XLogP | 2.72 |
| TPSA | 184.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |