C33H37F3N8O6 — CID 68917049
[(1S,2R,3S,5R)-5-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[2,2-bis(4-hydroxyphenyl)ethylamino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 68917049) has the molecular formula C33H37F3N8O6 and a molecular weight of 698.70 g/mol. Its IUPAC name is [(1S,2R,3S,5R)-5-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[2,2-bis(4-hydroxyphenyl)ethylamino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,2R,3S,5R)-5-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[2,2-bis(4-hydroxyphenyl)ethylamino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68917049 |
| Molecular Formula | C33H37F3N8O6 |
| Molecular Weight | 698.70 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | [(1S,2R,3S,5R)-5-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[2,2-bis(4-hydroxyphenyl)ethylamino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccc(O)cc4)c4ccc(O)cc4)nc(N4CC[C@@H](N)C4)nc32)[C@H](OC(=O)C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C33H37F3N8O6/c1-2-25(47)40-23-13-24(28(27(23)48)50-31(49)33(34,35)36)44-16-39-26-29(41-32(42-30(26)44)43-12-11-19(37)15-43)38-14-22(17-3-7-20(45)8-4-17)18-5-9-21(46)10-6-18/h3-10,16,19,22-24,27-28,45-46,48H,2,11-15,37H2,1H3,(H,40,47)(H,38,41,42)/t19-,23+,24-,27-,28+/m1/s1 |
| InChIKey | VNPKXJDYCFWSCM-GBDDAAIGSA-N |
| XLogP | 2.69 |
| TPSA | 200.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |