C34H38F3N7O4 — CID 69092206
[(1S,2R,3S,5R)-5-[2-(cyclopentylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 69092206) has the molecular formula C34H38F3N7O4 and a molecular weight of 665.72 g/mol. Its IUPAC name is [(1S,2R,3S,5R)-5-[2-(cyclopentylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,2R,3S,5R)-5-[2-(cyclopentylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69092206 |
| Molecular Formula | C34H38F3N7O4 |
| Molecular Weight | 665.72 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | [(1S,2R,3S,5R)-5-[2-(cyclopentylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NC4CCCC4)nc32)[C@H](OC(=O)C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C34H38F3N7O4/c1-2-26(45)41-24-17-25(29(28(24)46)48-32(47)34(35,36)37)44-19-39-27-30(42-33(43-31(27)44)40-22-15-9-10-16-22)38-18-23(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-8,11-14,19,22-25,28-29,46H,2,9-10,15-18H2,1H3,(H,41,45)(H2,38,40,42,43)/t24-,25+,28+,29-/m0/s1 |
| InChIKey | YPTCXCOXZJLDKP-QEJHQWKJSA-N |
| XLogP | 5.10 |
| TPSA | 143.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |