C36H40F3N9O3 — CID 69137175
[(1S,2S,3S,5S)-5-[2-[(4-aminocyclohexyl)amino]-6-(2,2-diphenylethylamino)purin-9-yl]-2-hydroxy-3-(4-methylpyrazol-1-yl)cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 69137175) has the molecular formula C36H40F3N9O3 and a molecular weight of 703.77 g/mol. Its IUPAC name is [(1S,2S,3S,5S)-5-[2-[(4-aminocyclohexyl)amino]-6-(2,2-diphenylethylamino)purin-9-yl]-2-hydroxy-3-(4-methylpyrazol-1-yl)cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,2S,3S,5S)-5-[2-[(4-aminocyclohexyl)amino]-6-(2,2-diphenylethylamino)purin-9-yl]-2-hydroxy-3-(4-methylpyrazol-1-yl)cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69137175 |
| Molecular Formula | C36H40F3N9O3 |
| Molecular Weight | 703.77 g/mol |
| Exact Mass | 703.32 |
| IUPAC Name | [(1S,2S,3S,5S)-5-[2-[(4-aminocyclohexyl)amino]-6-(2,2-diphenylethylamino)purin-9-yl]-2-hydroxy-3-(4-methylpyrazol-1-yl)cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cnn([C@H]2C[C@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NC5CCC(N)CC5)nc43)[C@H](OC(=O)C(F)(F)F)[C@H]2O)c1 |
| InChI | InChI=1S/C36H40F3N9O3/c1-21-17-43-48(19-21)27-16-28(31(30(27)49)51-34(50)36(37,38)39)47-20-42-29-32(45-35(46-33(29)47)44-25-14-12-24(40)13-15-25)41-18-26(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-11,17,19-20,24-28,30-31,49H,12-16,18,40H2,1H3,(H2,41,44,45,46)/t24?,25?,27-,28-,30-,31-/m0/s1 |
| InChIKey | UJNOJSYIAJVNHT-MLFDLCNFSA-N |
| XLogP | 5.28 |
| TPSA | 158.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |