C32H36F3N11O4 — CID 66736865
(1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[[(3R)-pyrrolidin-3-yl]amino]purin-9-yl]-5-(5-methyltetrazol-2-yl)cyclopentane-1,2-diol;2,2,2-trifluoroacetic acid (PubChem CID 66736865) has the molecular formula C32H36F3N11O4 and a molecular weight of 695.71 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[[(3R)-pyrrolidin-3-yl]amino]purin-9-yl]-5-(5-methyltetrazol-2-yl)cyclopentane-1,2-diol;2,2,2-trifluoroacetic acid.
| Compound Name | (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[[(3R)-pyrrolidin-3-yl]amino]purin-9-yl]-5-(5-methyltetrazol-2-yl)cyclopentane-1,2-diol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66736865 |
| Molecular Formula | C32H36F3N11O4 |
| Molecular Weight | 695.71 g/mol |
| Exact Mass | 695.29 |
| IUPAC Name | (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[[(3R)-pyrrolidin-3-yl]amino]purin-9-yl]-5-(5-methyltetrazol-2-yl)cyclopentane-1,2-diol;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nnn([C@H]2C[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(N[C@@H]5CCNC5)nc43)[C@H](O)[C@@H]2O)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H35N11O2.C2HF3O2/c1-18-37-39-41(38-18)24-14-23(26(42)27(24)43)40-17-33-25-28(35-30(36-29(25)40)34-21-12-13-31-15-21)32-16-22(19-8-4-2-5-9-19)20-10-6-3-7-11-20;3-2(4,5)1(6)7/h2-11,17,21-24,26-27,31,42-43H,12-16H2,1H3,(H2,32,34,35,36);(H,6,7)/t21-,23-,24+,26+,27-;/m1./s1 |
| InChIKey | OENNOOFUHKUKDH-YTYRTVTBSA-N |
| XLogP | 2.68 |
| TPSA | 201.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |