C32H36F3N9O4 — CID 66735883
(1R,2S,3R,5S)-3-[2-(2-aminoethylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-5-(4-methylpyrazol-1-yl)cyclopentane-1,2-diol;2,2,2-trifluoroacetic acid (PubChem CID 66735883) has the molecular formula C32H36F3N9O4 and a molecular weight of 667.69 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[2-(2-aminoethylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-5-(4-methylpyrazol-1-yl)cyclopentane-1,2-diol;2,2,2-trifluoroacetic acid.
| Compound Name | (1R,2S,3R,5S)-3-[2-(2-aminoethylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-5-(4-methylpyrazol-1-yl)cyclopentane-1,2-diol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66735883 |
| Molecular Formula | C32H36F3N9O4 |
| Molecular Weight | 667.69 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | (1R,2S,3R,5S)-3-[2-(2-aminoethylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-5-(4-methylpyrazol-1-yl)cyclopentane-1,2-diol;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cnn([C@H]2C[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NCCN)nc43)[C@H](O)[C@@H]2O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H35N9O2.C2HF3O2/c1-19-15-35-39(17-19)24-14-23(26(40)27(24)41)38-18-34-25-28(36-30(32-13-12-31)37-29(25)38)33-16-22(20-8-4-2-5-9-20)21-10-6-3-7-11-21;3-2(4,5)1(6)7/h2-11,15,17-18,22-24,26-27,40-41H,12-14,16,31H2,1H3,(H2,32,33,36,37);(H,6,7)/t23-,24+,26+,27-;/m1./s1 |
| InChIKey | RAKQTZKRQTUDBT-JNKVFAEFSA-N |
| XLogP | 3.49 |
| TPSA | 189.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |