C35H44N10O2 — CID 66737582
(1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]-5-(4-ethyltriazol-2-yl)cyclopentane-1,2-diol (PubChem CID 66737582) has the molecular formula C35H44N10O2 and a molecular weight of 636.81 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]-5-(4-ethyltriazol-2-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]-5-(4-ethyltriazol-2-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 66737582 |
| Molecular Formula | C35H44N10O2 |
| Molecular Weight | 636.81 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]-5-(4-ethyltriazol-2-yl)cyclopentane-1,2-diol |
| SMILES | CCc1cnn([C@H]2C[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NCCN5CCCCC5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C35H44N10O2/c1-2-26-21-39-45(42-26)29-20-28(31(46)32(29)47)44-23-38-30-33(40-35(41-34(30)44)36-16-19-43-17-10-5-11-18-43)37-22-27(24-12-6-3-7-13-24)25-14-8-4-9-15-25/h3-4,6-9,12-15,21,23,27-29,31-32,46-47H,2,5,10-11,16-20,22H2,1H3,(H2,36,37,40,41)/t28-,29+,31+,32-/m1/s1 |
| InChIKey | KYYCHFTVUYEOGH-FZSDTKOLSA-N |
| XLogP | 4.03 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.81 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |