C32H39N11O4 — CID 56615892
(2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-(2-morpholin-4-ylethylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 56615892) has the molecular formula C32H39N11O4 and a molecular weight of 641.74 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-(2-morpholin-4-ylethylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-(2-morpholin-4-ylethylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 56615892 |
| Molecular Formula | C32H39N11O4 |
| Molecular Weight | 641.74 g/mol |
| Exact Mass | 641.32 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-(2-morpholin-4-ylethylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NCCN5CCOCC5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C32H39N11O4/c1-2-43-39-29(38-40-43)27-25(44)26(45)31(47-27)42-20-35-24-28(36-32(37-30(24)42)33-13-14-41-15-17-46-18-16-41)34-19-23(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,20,23,25-27,31,44-45H,2,13-19H2,1H3,(H2,33,34,36,37)/t25-,26+,27-,31+/m0/s1 |
| InChIKey | CCYUSUQOSHABQD-OVDFTCDZSA-N |
| XLogP | 1.81 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.74 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |