C27H38N10O4 — CID 70117216
(2R,3R,4S,5R)-2-[6-(3,3-dimethylbutylamino)-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 70117216) has the molecular formula C27H38N10O4 and a molecular weight of 566.67 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(3,3-dimethylbutylamino)-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(3,3-dimethylbutylamino)-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70117216 |
| Molecular Formula | C27H38N10O4 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(3,3-dimethylbutylamino)-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCCC(C)(C)C)nc(NC(CO)Cc5ccccc5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C27H38N10O4/c1-5-37-34-23(33-35-37)21-19(39)20(40)25(41-21)36-15-29-18-22(28-12-11-27(2,3)4)31-26(32-24(18)36)30-17(14-38)13-16-9-7-6-8-10-16/h6-10,15,17,19-21,25,38-40H,5,11-14H2,1-4H3,(H2,28,30,31,32)/t17?,19-,20+,21-,25+/m0/s1 |
| InChIKey | QNCMSZROERSCMX-NROJUTCQSA-N |
| XLogP | 1.69 |
| TPSA | 181.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |