C29H34N10O5 — CID 70097955
(2R,3R,4S,5R)-2-[2,6-bis[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 70097955) has the molecular formula C29H34N10O5 and a molecular weight of 602.66 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2,6-bis[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2,6-bis[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70097955 |
| Molecular Formula | C29H34N10O5 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2,6-bis[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | Cn1nnc([C@H]2O[C@@H](n3cnc4c(N[C@H](CO)Cc5ccccc5)nc(N[C@H](CO)Cc5ccccc5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C29H34N10O5/c1-38-36-26(35-37-38)24-22(42)23(43)28(44-24)39-16-30-21-25(31-19(14-40)12-17-8-4-2-5-9-17)33-29(34-27(21)39)32-20(15-41)13-18-10-6-3-7-11-18/h2-11,16,19-20,22-24,28,40-43H,12-15H2,1H3,(H2,31,32,33,34)/t19-,20-,22-,23+,24-,28+/m0/s1 |
| InChIKey | CTVATCZNZUSDBL-CAJRIUSNSA-N |
| XLogP | 0.37 |
| TPSA | 201.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |