C30H35N9O5 — CID 70140668
(2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[6-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-[2-(pyridin-2-ylamino)ethylamino]purin-9-yl]oxolane-3,4-diol (PubChem CID 70140668) has the molecular formula C30H35N9O5 and a molecular weight of 601.67 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[6-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-[2-(pyridin-2-ylamino)ethylamino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[6-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-[2-(pyridin-2-ylamino)ethylamino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70140668 |
| Molecular Formula | C30H35N9O5 |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[6-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-[2-(pyridin-2-ylamino)ethylamino]purin-9-yl]oxolane-3,4-diol |
| SMILES | CCc1cc([C@H]2O[C@@H](n3cnc4c(NC(CO)Cc5ccccc5)nc(NCCNc5ccccn5)nc43)[C@H](O)[C@@H]2O)on1 |
| InChI | InChI=1S/C30H35N9O5/c1-2-19-15-21(44-38-19)26-24(41)25(42)29(43-26)39-17-34-23-27(35-20(16-40)14-18-8-4-3-5-9-18)36-30(37-28(23)39)33-13-12-32-22-10-6-7-11-31-22/h3-11,15,17,20,24-26,29,40-42H,2,12-14,16H2,1H3,(H,31,32)(H2,33,35,36,37)/t20?,24-,25+,26+,29+/m0/s1 |
| InChIKey | ZHSGLZJDZRAOQL-QOEXHYRTSA-N |
| XLogP | 2.30 |
| TPSA | 188.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|