C28H35N7O5S — CID 70141243
(2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-6-(thian-4-ylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 70141243) has the molecular formula C28H35N7O5S and a molecular weight of 581.70 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-6-(thian-4-ylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-6-(thian-4-ylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70141243 |
| Molecular Formula | C28H35N7O5S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-6-(thian-4-ylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | CCc1cc([C@H]2O[C@@H](n3cnc4c(NC5CCSCC5)nc(NC(CO)Cc5ccccc5)nc43)[C@H](O)[C@@H]2O)on1 |
| InChI | InChI=1S/C28H35N7O5S/c1-2-17-13-20(40-34-17)24-22(37)23(38)27(39-24)35-15-29-21-25(30-18-8-10-41-11-9-18)32-28(33-26(21)35)31-19(14-36)12-16-6-4-3-5-7-16/h3-7,13,15,18-19,22-24,27,36-38H,2,8-12,14H2,1H3,(H2,30,31,32,33)/t19?,22-,23+,24+,27+/m0/s1 |
| InChIKey | PWWJHXKFDFXEQU-WMEFFSRKSA-N |
| XLogP | 2.69 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |