C25H33N11O4 — CID 70099154
(2R,3S,4R,5R)-2-(2-ethyltetrazol-5-yl)-5-[6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-(pyrrolidin-3-ylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 70099154) has the molecular formula C25H33N11O4 and a molecular weight of 551.61 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(2-ethyltetrazol-5-yl)-5-[6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-(pyrrolidin-3-ylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(2-ethyltetrazol-5-yl)-5-[6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-(pyrrolidin-3-ylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70099154 |
| Molecular Formula | C25H33N11O4 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | (2R,3S,4R,5R)-2-(2-ethyltetrazol-5-yl)-5-[6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-(pyrrolidin-3-ylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(N[C@H](CO)Cc5ccccc5)nc(NC5CCNC5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C25H33N11O4/c1-2-36-33-22(32-34-36)20-18(38)19(39)24(40-20)35-13-27-17-21(28-16(12-37)10-14-6-4-3-5-7-14)30-25(31-23(17)35)29-15-8-9-26-11-15/h3-7,13,15-16,18-20,24,26,37-39H,2,8-12H2,1H3,(H2,28,29,30,31)/t15?,16-,18-,19+,20-,24+/m0/s1 |
| InChIKey | BMGUGWJAVBJODA-NUNSXDRSSA-N |
| XLogP | -0.39 |
| TPSA | 193.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |