C21H25N11O6 — CID 11386951
(2R,3R,4S,5R)-2-[6-amino-2-[[(2S)-1-hydroxy-3-(4-nitrophenyl)propan-2-yl]amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 11386951) has the molecular formula C21H25N11O6 and a molecular weight of 527.50 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[[(2S)-1-hydroxy-3-(4-nitrophenyl)propan-2-yl]amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[[(2S)-1-hydroxy-3-(4-nitrophenyl)propan-2-yl]amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11386951 |
| Molecular Formula | C21H25N11O6 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[[(2S)-1-hydroxy-3-(4-nitrophenyl)propan-2-yl]amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(N)nc(N[C@H](CO)Cc5ccc([N+](=O)[O-])cc5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C21H25N11O6/c1-2-31-28-18(27-29-31)16-14(34)15(35)20(38-16)30-9-23-13-17(22)25-21(26-19(13)30)24-11(8-33)7-10-3-5-12(6-4-10)32(36)37/h3-6,9,11,14-16,20,33-35H,2,7-8H2,1H3,(H3,22,24,25,26)/t11-,14-,15+,16-,20+/m0/s1 |
| InChIKey | VNNIWUZWLZWHIP-OIODXMIOSA-N |
| XLogP | -0.67 |
| TPSA | 238.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|