C24H27F3N10O6 — CID 70025966
[(2R,3R,4R,5R)-2-[6-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 70025966) has the molecular formula C24H27F3N10O6 and a molecular weight of 608.54 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[6-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3R,4R,5R)-2-[6-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70025966 |
| Molecular Formula | C24H27F3N10O6 |
| Molecular Weight | 608.54 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[6-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(N)nc(NCCc5ccc(OC)c(OC)c5)nc43)[C@H](OC(=O)C(F)(F)F)[C@@H]2O)n1 |
| InChI | InChI=1S/C24H27F3N10O6/c1-4-37-34-19(33-35-37)16-15(38)17(43-22(39)24(25,26)27)21(42-16)36-10-30-14-18(28)31-23(32-20(14)36)29-8-7-11-5-6-12(40-2)13(9-11)41-3/h5-6,9-10,15-17,21,38H,4,7-8H2,1-3H3,(H3,28,29,31,32)/t15-,16+,17-,21-/m1/s1 |
| InChIKey | GALFQHYJIGLYLG-KYFSNAEOSA-N |
| XLogP | 1.19 |
| TPSA | 199.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |