C22H28N10O6 — CID 70026027
(2R,3R,4S,5R)-2-[6-amino-2-[2-(4-methoxyphenyl)ethylamino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol;formic acid (PubChem CID 70026027) has the molecular formula C22H28N10O6 and a molecular weight of 528.53 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[2-(4-methoxyphenyl)ethylamino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol;formic acid.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[2-(4-methoxyphenyl)ethylamino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol;formic acid |
|---|---|
| PubChem CID | 70026027 |
| Molecular Formula | C22H28N10O6 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[2-(4-methoxyphenyl)ethylamino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol;formic acid |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(N)nc(NCCc5ccc(OC)cc5)nc43)[C@H](O)[C@@H]2O)n1.O=CO |
| InChI | InChI=1S/C21H26N10O4.CH2O2/c1-3-31-28-18(27-29-31)16-14(32)15(33)20(35-16)30-10-24-13-17(22)25-21(26-19(13)30)23-9-8-11-4-6-12(34-2)7-5-11;2-1-3/h4-7,10,14-16,20,32-33H,3,8-9H2,1-2H3,(H3,22,23,25,26);1H,(H,2,3)/t14-,15+,16-,20+;/m0./s1 |
| InChIKey | CLZGFZLXUJCDAL-GDGFGLPISA-N |
| XLogP | -0.23 |
| TPSA | 221.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|