C20H26N6O6 — CID 46876406
(3R,4S,5R)-2-[6-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46876406) has the molecular formula C20H26N6O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46876406 |
| Molecular Formula | C20H26N6O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (3R,4S,5R)-2-[6-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1ccc(CCNc2nc(N)c3ncn(C4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)cc1OC |
| InChI | InChI=1S/C20H26N6O6/c1-30-11-4-3-10(7-12(11)31-2)5-6-22-20-24-17(21)14-18(25-20)26(9-23-14)19-16(29)15(28)13(8-27)32-19/h3-4,7,9,13,15-16,19,27-29H,5-6,8H2,1-2H3,(H3,21,22,24,25)/t13-,15-,16-,19?/m1/s1 |
| InChIKey | ZAXKVJXXLHQAOL-XAUNWSGPSA-N |
| XLogP | -0.31 |
| TPSA | 170.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |