C21H26N10O4 — CID 10184455
(2R,3R,4S,5R)-2-[6-amino-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 10184455) has the molecular formula C21H26N10O4 and a molecular weight of 482.51 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10184455 |
| Molecular Formula | C21H26N10O4 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(N)nc(NC(CO)Cc5ccccc5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C21H26N10O4/c1-2-31-28-18(27-29-31)16-14(33)15(34)20(35-16)30-10-23-13-17(22)25-21(26-19(13)30)24-12(9-32)8-11-6-4-3-5-7-11/h3-7,10,12,14-16,20,32-34H,2,8-9H2,1H3,(H3,22,24,25,26)/t12?,14-,15+,16-,20+/m0/s1 |
| InChIKey | FLBKPDIBGNWXMT-IKHDRVDBSA-N |
| XLogP | -0.58 |
| TPSA | 195.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |