C28H33N11O3 — CID 69306608
(2R,3R,4S,5R)-2-[2-(2-aminoethylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 69306608) has the molecular formula C28H33N11O3 and a molecular weight of 571.65 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-(2-aminoethylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-(2-aminoethylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 69306608 |
| Molecular Formula | C28H33N11O3 |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-(2-aminoethylamino)-6-(2,2-diphenylethylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NCCN)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C28H33N11O3/c1-2-39-36-25(35-37-39)23-21(40)22(41)27(42-23)38-16-32-20-24(33-28(30-14-13-29)34-26(20)38)31-15-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19,21-23,27,40-41H,2,13-15,29H2,1H3,(H2,30,31,33,34)/t21-,22+,23-,27+/m0/s1 |
| InChIKey | WPWTYZPOCZJHTN-NBCVKUGOSA-N |
| XLogP | 1.44 |
| TPSA | 186.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |