C31H34IN11O5 — CID 68834347
[1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(2-ethyltetrazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]-2-iodopyrrolidin-3-yl]carbamic acid (PubChem CID 68834347) has the molecular formula C31H34IN11O5 and a molecular weight of 767.59 g/mol. Its IUPAC name is [1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(2-ethyltetrazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]-2-iodopyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(2-ethyltetrazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]-2-iodopyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68834347 |
| Molecular Formula | C31H34IN11O5 |
| Molecular Weight | 767.59 g/mol |
| Exact Mass | 767.18 |
| IUPAC Name | [1-[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(2-ethyltetrazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]-2-iodopyrrolidin-3-yl]carbamic acid |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(N5CCC(NC(=O)O)C5I)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C31H34IN11O5/c1-2-43-39-27(38-40-43)24-22(44)23(45)29(48-24)42-16-34-21-26(33-15-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18)36-30(37-28(21)42)41-14-13-20(25(41)32)35-31(46)47/h3-12,16,19-20,22-25,29,35,44-45H,2,13-15H2,1H3,(H,46,47)(H,33,36,37)/t20?,22-,23+,24-,25?,29+/m0/s1 |
| InChIKey | BILVQXXASFSBTL-BEKVNYPNSA-N |
| XLogP | 2.68 |
| TPSA | 201.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|